C11H13FIN5O3 — CID 11223569
(2R,3R,4S,5R)-5-(2,4-diamino-5-iodopyrrolo[2,3-d]pyrimidin-7-yl)-4-fluoro-2-(hydroxymethyl)oxolan-3-ol (PubChem CID 11223569) has the molecular formula C11H13FIN5O3 and a molecular weight of 409.16 g/mol. Its IUPAC name is (2R,3R,4S,5R)-5-(2,4-diamino-5-iodopyrrolo[2,3-d]pyrimidin-7-yl)-4-fluoro-2-(hydroxymethyl)oxolan-3-ol.
| Compound Name | (2R,3R,4S,5R)-5-(2,4-diamino-5-iodopyrrolo[2,3-d]pyrimidin-7-yl)-4-fluoro-2-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 11223569 |
| Molecular Formula | C11H13FIN5O3 |
| Molecular Weight | 409.16 g/mol |
| Exact Mass | 409.00 |
| IUPAC Name | (2R,3R,4S,5R)-5-(2,4-diamino-5-iodopyrrolo[2,3-d]pyrimidin-7-yl)-4-fluoro-2-(hydroxymethyl)oxolan-3-ol |
| SMILES | Nc1nc(N)c2c(I)cn([C@@H]3O[C@H](CO)[C@@H](O)[C@@H]3F)c2n1 |
| InChI | InChI=1S/C11H13FIN5O3/c12-6-7(20)4(2-19)21-10(6)18-1-3(13)5-8(14)16-11(15)17-9(5)18/h1,4,6-7,10,19-20H,2H2,(H4,14,15,16,17)/t4-,6+,7-,10-/m1/s1 |
| InChIKey | VLQUHZIMLWSYCS-GAWUUDPSSA-N |
| XLogP | -0.21 |
| TPSA | 132.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.16 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|