C23H35ClO5 — CID 11224087
methyl (5E,7E)-8-[(4R,5R)-5-[(E)-5-chloro-4-methylpent-3-enyl]-2,2-dimethyl-1,3-dioxan-4-yl]-4,4-dimethyl-3-oxoocta-5,7-dienoate (PubChem CID 11224087) has the molecular formula C23H35ClO5 and a molecular weight of 426.98 g/mol. Its IUPAC name is methyl (5E,7E)-8-[(4R,5R)-5-[(E)-5-chloro-4-methylpent-3-enyl]-2,2-dimethyl-1,3-dioxan-4-yl]-4,4-dimethyl-3-oxoocta-5,7-dienoate.
| Compound Name | methyl (5E,7E)-8-[(4R,5R)-5-[(E)-5-chloro-4-methylpent-3-enyl]-2,2-dimethyl-1,3-dioxan-4-yl]-4,4-dimethyl-3-oxoocta-5,7-dienoate |
|---|---|
| PubChem CID | 11224087 |
| Molecular Formula | C23H35ClO5 |
| Molecular Weight | 426.98 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | methyl (5E,7E)-8-[(4R,5R)-5-[(E)-5-chloro-4-methylpent-3-enyl]-2,2-dimethyl-1,3-dioxan-4-yl]-4,4-dimethyl-3-oxoocta-5,7-dienoate |
| SMILES | COC(=O)CC(=O)C(C)(C)/C=C/C=C/[C@H]1OC(C)(C)OC[C@H]1CC/C=C(\C)CCl |
| InChI | InChI=1S/C23H35ClO5/c1-17(15-24)10-9-11-18-16-28-23(4,5)29-19(18)12-7-8-13-22(2,3)20(25)14-21(26)27-6/h7-8,10,12-13,18-19H,9,11,14-16H2,1-6H3/b12-7+,13-8+,17-10+/t18-,19-/m1/s1 |
| InChIKey | STNVCFSKOVRFRP-ITHNDNGFSA-N |
| XLogP | 4.99 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.98 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|