C23H34O5 — CID 11383726
methyl (1R,4E,10E,12E,14R)-5,9,9,16,16-pentamethyl-8-oxo-15,17-dioxabicyclo[12.4.0]octadeca-4,10,12-triene-7-carboxylate (PubChem CID 11383726) has the molecular formula C23H34O5 and a molecular weight of 390.52 g/mol. Its IUPAC name is methyl (1R,4E,10E,12E,14R)-5,9,9,16,16-pentamethyl-8-oxo-15,17-dioxabicyclo[12.4.0]octadeca-4,10,12-triene-7-carboxylate.
| Compound Name | methyl (1R,4E,10E,12E,14R)-5,9,9,16,16-pentamethyl-8-oxo-15,17-dioxabicyclo[12.4.0]octadeca-4,10,12-triene-7-carboxylate |
|---|---|
| PubChem CID | 11383726 |
| Molecular Formula | C23H34O5 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | methyl (1R,4E,10E,12E,14R)-5,9,9,16,16-pentamethyl-8-oxo-15,17-dioxabicyclo[12.4.0]octadeca-4,10,12-triene-7-carboxylate |
| SMILES | COC(=O)C1C/C(C)=C/CC[C@@H]2COC(C)(C)O[C@@H]2/C=C/C=C/C(C)(C)C1=O |
| InChI | InChI=1S/C23H34O5/c1-16-10-9-11-17-15-27-23(4,5)28-19(17)12-7-8-13-22(2,3)20(24)18(14-16)21(25)26-6/h7-8,10,12-13,17-19H,9,11,14-15H2,1-6H3/b12-7+,13-8+,16-10+/t17-,18?,19-/m1/s1 |
| InChIKey | YQNSMJHQYRZTAV-KLNMYWQJSA-N |
| XLogP | 4.38 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|