C23H35IO5 — CID 10697238
methyl (3R,4E,6E,8E)-10-[(4S,5S,6R)-6-[(Z)-4-iodobut-2-en-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]-3-methoxydeca-4,6,8-trienoate (PubChem CID 10697238) has the molecular formula C23H35IO5 and a molecular weight of 518.43 g/mol. Its IUPAC name is methyl (3R,4E,6E,8E)-10-[(4S,5S,6R)-6-[(Z)-4-iodobut-2-en-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]-3-methoxydeca-4,6,8-trienoate.
| Compound Name | methyl (3R,4E,6E,8E)-10-[(4S,5S,6R)-6-[(Z)-4-iodobut-2-en-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]-3-methoxydeca-4,6,8-trienoate |
|---|---|
| PubChem CID | 10697238 |
| Molecular Formula | C23H35IO5 |
| Molecular Weight | 518.43 g/mol |
| Exact Mass | 518.15 |
| IUPAC Name | methyl (3R,4E,6E,8E)-10-[(4S,5S,6R)-6-[(Z)-4-iodobut-2-en-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]-3-methoxydeca-4,6,8-trienoate |
| SMILES | COC(=O)C[C@H](/C=C/C=C/C=C/C[C@@H]1OC(C)(C)O[C@@H](/C(C)=C\CI)[C@H]1C)OC |
| InChI | InChI=1S/C23H35IO5/c1-17(14-15-24)22-18(2)20(28-23(3,4)29-22)13-11-9-7-8-10-12-19(26-5)16-21(25)27-6/h7-12,14,18-20,22H,13,15-16H2,1-6H3/b8-7+,11-9+,12-10+,17-14-/t18-,19-,20-,22-/m0/s1 |
| InChIKey | GVMXSIUTWCWNMG-VFKSGPKHSA-N |
| XLogP | 5.16 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.43 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|