C24H38O6 — CID 10550172
[(Z)-3-[(4R,5S,6S)-6-[(2E,4E,6E,8R)-10-hydroxy-8-methoxydeca-2,4,6-trienyl]-2,2,5-trimethyl-1,3-dioxan-4-yl]but-2-enyl] acetate (PubChem CID 10550172) has the molecular formula C24H38O6 and a molecular weight of 422.56 g/mol. Its IUPAC name is [(Z)-3-[(4R,5S,6S)-6-[(2E,4E,6E,8R)-10-hydroxy-8-methoxydeca-2,4,6-trienyl]-2,2,5-trimethyl-1,3-dioxan-4-yl]but-2-enyl] acetate.
| Compound Name | [(Z)-3-[(4R,5S,6S)-6-[(2E,4E,6E,8R)-10-hydroxy-8-methoxydeca-2,4,6-trienyl]-2,2,5-trimethyl-1,3-dioxan-4-yl]but-2-enyl] acetate |
|---|---|
| PubChem CID | 10550172 |
| Molecular Formula | C24H38O6 |
| Molecular Weight | 422.56 g/mol |
| Exact Mass | 422.27 |
| IUPAC Name | [(Z)-3-[(4R,5S,6S)-6-[(2E,4E,6E,8R)-10-hydroxy-8-methoxydeca-2,4,6-trienyl]-2,2,5-trimethyl-1,3-dioxan-4-yl]but-2-enyl] acetate |
| SMILES | CO[C@@H](/C=C/C=C/C=C/C[C@@H]1OC(C)(C)O[C@@H](/C(C)=C\COC(C)=O)[C@H]1C)CCO |
| InChI | InChI=1S/C24H38O6/c1-18(15-17-28-20(3)26)23-19(2)22(29-24(4,5)30-23)13-11-9-7-8-10-12-21(27-6)14-16-25/h7-12,15,19,21-23,25H,13-14,16-17H2,1-6H3/b8-7+,11-9+,12-10+,18-15-/t19-,21-,22-,23-/m0/s1 |
| InChIKey | QROYRMHBXZMIPM-RLBXILIBSA-N |
| XLogP | 4.11 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.56 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|