C20H28O4 — CID 134938993
ethyl (2E,4E,6R)-6-[(3R,5S)-1,4-dimethyl-8-methylidene-2,9-dioxabicyclo[3.3.1]non-6-en-3-yl]-4-methylhepta-2,4-dienoate (PubChem CID 134938993) has the molecular formula C20H28O4 and a molecular weight of 332.44 g/mol. Its IUPAC name is ethyl (2E,4E,6R)-6-[(3R,5S)-1,4-dimethyl-8-methylidene-2,9-dioxabicyclo[3.3.1]non-6-en-3-yl]-4-methylhepta-2,4-dienoate.
| Compound Name | ethyl (2E,4E,6R)-6-[(3R,5S)-1,4-dimethyl-8-methylidene-2,9-dioxabicyclo[3.3.1]non-6-en-3-yl]-4-methylhepta-2,4-dienoate |
|---|---|
| PubChem CID | 134938993 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | ethyl (2E,4E,6R)-6-[(3R,5S)-1,4-dimethyl-8-methylidene-2,9-dioxabicyclo[3.3.1]non-6-en-3-yl]-4-methylhepta-2,4-dienoate |
| SMILES | C=C1C=C[C@@H]2OC1(C)O[C@H]([C@H](C)/C=C(C)/C=C/C(=O)OCC)C2C |
| InChI | InChI=1S/C20H28O4/c1-7-22-18(21)11-8-13(2)12-14(3)19-16(5)17-10-9-15(4)20(6,23-17)24-19/h8-12,14,16-17,19H,4,7H2,1-3,5-6H3/b11-8+,13-12+/t14-,16?,17+,19-,20?/m1/s1 |
| InChIKey | UFCYCAMCQYPVDO-NCGHCRSNSA-N |
| XLogP | 3.95 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|