C29H46O5 — CID 90805115
12-[8-(6-ethyl-5-methyl-2-oxo-1,3-dioxan-4-yl)-6-methylocta-2,4-dien-2-yl]-7,11-dimethyl-1-oxacyclododec-9-en-2-one (PubChem CID 90805115) has the molecular formula C29H46O5 and a molecular weight of 474.68 g/mol. Its IUPAC name is 12-[8-(6-ethyl-5-methyl-2-oxo-1,3-dioxan-4-yl)-6-methylocta-2,4-dien-2-yl]-7,11-dimethyl-1-oxacyclododec-9-en-2-one.
| Compound Name | 12-[8-(6-ethyl-5-methyl-2-oxo-1,3-dioxan-4-yl)-6-methylocta-2,4-dien-2-yl]-7,11-dimethyl-1-oxacyclododec-9-en-2-one |
|---|---|
| PubChem CID | 90805115 |
| Molecular Formula | C29H46O5 |
| Molecular Weight | 474.68 g/mol |
| Exact Mass | 474.33 |
| IUPAC Name | 12-[8-(6-ethyl-5-methyl-2-oxo-1,3-dioxan-4-yl)-6-methylocta-2,4-dien-2-yl]-7,11-dimethyl-1-oxacyclododec-9-en-2-one |
| SMILES | CCC1OC(=O)OC(CCC(C)C=CC=C(C)C2OC(=O)CCCCC(C)CC=CC2C)C1C |
| InChI | InChI=1S/C29H46O5/c1-7-25-24(6)26(33-29(31)32-25)19-18-21(3)14-11-16-23(5)28-22(4)15-10-13-20(2)12-8-9-17-27(30)34-28/h10-11,14-16,20-22,24-26,28H,7-9,12-13,17-19H2,1-6H3 |
| InChIKey | SVIDRAPDMOVRMF-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.68 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|