C19H19IN2O3 — CID 11224721
2-(1-acetylindol-3-yl)-N-(furan-2-yl)-N-(3-iodopropyl)acetamide (PubChem CID 11224721) has the molecular formula C19H19IN2O3 and a molecular weight of 450.28 g/mol. Its IUPAC name is 2-(1-acetylindol-3-yl)-N-(furan-2-yl)-N-(3-iodopropyl)acetamide.
| Compound Name | 2-(1-acetylindol-3-yl)-N-(furan-2-yl)-N-(3-iodopropyl)acetamide |
|---|---|
| PubChem CID | 11224721 |
| Molecular Formula | C19H19IN2O3 |
| Molecular Weight | 450.28 g/mol |
| Exact Mass | 450.04 |
| IUPAC Name | 2-(1-acetylindol-3-yl)-N-(furan-2-yl)-N-(3-iodopropyl)acetamide |
| SMILES | CC(=O)n1cc(CC(=O)N(CCCI)c2ccco2)c2ccccc21 |
| InChI | InChI=1S/C19H19IN2O3/c1-14(23)22-13-15(16-6-2-3-7-17(16)22)12-18(24)21(10-5-9-20)19-8-4-11-25-19/h2-4,6-8,11,13H,5,9-10,12H2,1H3 |
| InChIKey | IWIJIULESFWNEV-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 55.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.28 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|