C21H22N2O3 — CID 2228540
1-(azepan-1-yl)-2-[3-(furan-2-carbonyl)indol-1-yl]ethanone (PubChem CID 2228540) has the molecular formula C21H22N2O3 and a molecular weight of 350.42 g/mol. Its IUPAC name is 1-(azepan-1-yl)-2-[3-(furan-2-carbonyl)indol-1-yl]ethanone.
| Compound Name | 1-(azepan-1-yl)-2-[3-(furan-2-carbonyl)indol-1-yl]ethanone |
|---|---|
| PubChem CID | 2228540 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | 1-(azepan-1-yl)-2-[3-(furan-2-carbonyl)indol-1-yl]ethanone |
| SMILES | O=C(c1ccco1)c1cn(CC(=O)N2CCCCCC2)c2ccccc12 |
| InChI | InChI=1S/C21H22N2O3/c24-20(22-11-5-1-2-6-12-22)15-23-14-17(16-8-3-4-9-18(16)23)21(25)19-10-7-13-26-19/h3-4,7-10,13-14H,1-2,5-6,11-12,15H2 |
| InChIKey | JTYKWEMZBUCGMH-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 55.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |