C18H18N2O4 — CID 3157244
2-[3-(furan-2-carbonyl)indol-1-yl]-N-(2-methoxyethyl)acetamide (PubChem CID 3157244) has the molecular formula C18H18N2O4 and a molecular weight of 326.35 g/mol. Its IUPAC name is 2-[3-(furan-2-carbonyl)indol-1-yl]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[3-(furan-2-carbonyl)indol-1-yl]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 3157244 |
| Molecular Formula | C18H18N2O4 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 2-[3-(furan-2-carbonyl)indol-1-yl]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)Cn1cc(C(=O)c2ccco2)c2ccccc21 |
| InChI | InChI=1S/C18H18N2O4/c1-23-10-8-19-17(21)12-20-11-14(13-5-2-3-6-15(13)20)18(22)16-7-4-9-24-16/h2-7,9,11H,8,10,12H2,1H3,(H,19,21) |
| InChIKey | FWCKJLXFEXPEJR-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|