C25H27FN4O2 — CID 11316467
5-[4-[4-(5-fluoro-1H-indol-3-yl)butyl]piperazin-1-yl]-1-benzofuran-2-carboxamide (PubChem CID 11316467) has the molecular formula C25H27FN4O2 and a molecular weight of 434.52 g/mol. Its IUPAC name is 5-[4-[4-(5-fluoro-1H-indol-3-yl)butyl]piperazin-1-yl]-1-benzofuran-2-carboxamide.
| Compound Name | 5-[4-[4-(5-fluoro-1H-indol-3-yl)butyl]piperazin-1-yl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 11316467 |
| Molecular Formula | C25H27FN4O2 |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | 5-[4-[4-(5-fluoro-1H-indol-3-yl)butyl]piperazin-1-yl]-1-benzofuran-2-carboxamide |
| SMILES | NC(=O)c1cc2cc(N3CCN(CCCCc4c[nH]c5ccc(F)cc45)CC3)ccc2o1 |
| InChI | InChI=1S/C25H27FN4O2/c26-19-4-6-22-21(15-19)17(16-28-22)3-1-2-8-29-9-11-30(12-10-29)20-5-7-23-18(13-20)14-24(32-23)25(27)31/h4-7,13-16,28H,1-3,8-12H2,(H2,27,31) |
| InChIKey | GGTNSGOMXSGNLN-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 78.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|