C26H25N5O — CID 11441638
3-{4-[4-(2-Cyano-benzofuran-5-yl)-piperazin-1-yl]-butyl}-1H-indole-5-carbonitrile (PubChem CID 11441638) has the molecular formula C26H25N5O and a molecular weight of 423.50 g/mol. Its IUPAC name is 3-[4-[4-(2-cyano-1-benzofuran-5-yl)piperazin-1-yl]butyl]-1H-indole-5-carbonitrile.
| Compound Name | 3-{4-[4-(2-Cyano-benzofuran-5-yl)-piperazin-1-yl]-butyl}-1H-indole-5-carbonitrile |
|---|---|
| PubChem CID | 11441638 |
| Molecular Formula | C26H25N5O |
| Molecular Weight | 423.50 g/mol |
| Exact Mass | 423.21 |
| IUPAC Name | 3-[4-[4-(2-cyano-1-benzofuran-5-yl)piperazin-1-yl]butyl]-1H-indole-5-carbonitrile |
| SMILES | C1CN(CCN1CCCCC2=CNC3=C2C=C(C=C3)C#N)C4=CC5=C(C=C4)OC(=C5)C#N |
| InChI | InChI=1S/C26H25N5O/c27-16-19-4-6-25-24(13-19)20(18-29-25)3-1-2-8-30-9-11-31(12-10-30)22-5-7-26-21(14-22)15-23(17-28)32-26/h4-7,13-15,18,29H,1-3,8-12H2 |
| InChIKey | GMSXHDFLWANNPI-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 83.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | 731 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.50 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|