C28H19N5O4 — CID 71733737
3-(1-benzofuran-3-yl)-4-[10-(pyrazine-2-carbonyl)-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-3-yl]pyrrole-2,5-dione (PubChem CID 71733737) has the molecular formula C28H19N5O4 and a molecular weight of 489.49 g/mol. Its IUPAC name is 3-(1-benzofuran-3-yl)-4-[10-(pyrazine-2-carbonyl)-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-3-yl]pyrrole-2,5-dione.
| Compound Name | 3-(1-benzofuran-3-yl)-4-[10-(pyrazine-2-carbonyl)-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-3-yl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 71733737 |
| Molecular Formula | C28H19N5O4 |
| Molecular Weight | 489.49 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | 3-(1-benzofuran-3-yl)-4-[10-(pyrazine-2-carbonyl)-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-3-yl]pyrrole-2,5-dione |
| SMILES | O=C1NC(=O)C(c2cn3c4c(cccc24)CN(C(=O)c2cnccn2)CC3)=C1c1coc2ccccc12 |
| InChI | InChI=1S/C28H19N5O4/c34-26-23(24(27(35)31-26)20-15-37-22-7-2-1-5-17(20)22)19-14-32-10-11-33(28(36)21-12-29-8-9-30-21)13-16-4-3-6-18(19)25(16)32/h1-9,12,14-15H,10-11,13H2,(H,31,34,35) |
| InChIKey | CISDYZOOSAEOAZ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 110.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.49 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|