C34H34FN5O4 — CID 71733742
3-(1-benzofuran-3-yl)-4-[6-fluoro-10-(4-piperidin-1-ylpiperidine-1-carbonyl)-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-3-yl]pyrrole-2,5-dione (PubChem CID 71733742) has the molecular formula C34H34FN5O4 and a molecular weight of 595.68 g/mol. Its IUPAC name is 3-(1-benzofuran-3-yl)-4-[6-fluoro-10-(4-piperidin-1-ylpiperidine-1-carbonyl)-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-3-yl]pyrrole-2,5-dione.
| Compound Name | 3-(1-benzofuran-3-yl)-4-[6-fluoro-10-(4-piperidin-1-ylpiperidine-1-carbonyl)-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-3-yl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 71733742 |
| Molecular Formula | C34H34FN5O4 |
| Molecular Weight | 595.68 g/mol |
| Exact Mass | 595.26 |
| IUPAC Name | 3-(1-benzofuran-3-yl)-4-[6-fluoro-10-(4-piperidin-1-ylpiperidine-1-carbonyl)-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-3-yl]pyrrole-2,5-dione |
| SMILES | O=C1NC(=O)C(c2cn3c4c(cc(F)cc24)CN(C(=O)N2CCC(N4CCCCC4)CC2)CC3)=C1c1coc2ccccc12 |
| InChI | InChI=1S/C34H34FN5O4/c35-22-16-21-18-40(34(43)38-12-8-23(9-13-38)37-10-4-1-5-11-37)15-14-39-19-26(25(17-22)31(21)39)29-30(33(42)36-32(29)41)27-20-44-28-7-3-2-6-24(27)28/h2-3,6-7,16-17,19-20,23H,1,4-5,8-15,18H2,(H,36,41,42) |
| InChIKey | QAFJCEUJWVLFFS-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 91.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.68 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|