C26H17FN2O3 — CID 24991913
3-[5-(2-cyclopropylethynyl)-1-methylindol-3-yl]-4-(5-fluoro-1-benzofuran-3-yl)pyrrole-2,5-dione (PubChem CID 24991913) has the molecular formula C26H17FN2O3 and a molecular weight of 424.43 g/mol. Its IUPAC name is 3-[5-(2-cyclopropylethynyl)-1-methylindol-3-yl]-4-(5-fluoro-1-benzofuran-3-yl)pyrrole-2,5-dione.
| Compound Name | 3-[5-(2-cyclopropylethynyl)-1-methylindol-3-yl]-4-(5-fluoro-1-benzofuran-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 24991913 |
| Molecular Formula | C26H17FN2O3 |
| Molecular Weight | 424.43 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | 3-[5-(2-cyclopropylethynyl)-1-methylindol-3-yl]-4-(5-fluoro-1-benzofuran-3-yl)pyrrole-2,5-dione |
| SMILES | Cn1cc(C2=C(c3coc4ccc(F)cc34)C(=O)NC2=O)c2cc(C#CC3CC3)ccc21 |
| InChI | InChI=1S/C26H17FN2O3/c1-29-12-19(17-10-15(6-8-21(17)29)5-4-14-2-3-14)23-24(26(31)28-25(23)30)20-13-32-22-9-7-16(27)11-18(20)22/h6-14H,2-3H2,1H3,(H,28,30,31) |
| InChIKey | ZEVFHALEZXQWMF-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 64.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.43 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|