C22H14ClFN2O4 — CID 44582684
3-(6-chloro-5-fluoro-1-methylindol-3-yl)-4-[6-(hydroxymethyl)-1-benzofuran-3-yl]pyrrole-2,5-dione (PubChem CID 44582684) has the molecular formula C22H14ClFN2O4 and a molecular weight of 424.82 g/mol. Its IUPAC name is 3-(6-chloro-5-fluoro-1-methylindol-3-yl)-4-[6-(hydroxymethyl)-1-benzofuran-3-yl]pyrrole-2,5-dione.
| Compound Name | 3-(6-chloro-5-fluoro-1-methylindol-3-yl)-4-[6-(hydroxymethyl)-1-benzofuran-3-yl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 44582684 |
| Molecular Formula | C22H14ClFN2O4 |
| Molecular Weight | 424.82 g/mol |
| Exact Mass | 424.06 |
| IUPAC Name | 3-(6-chloro-5-fluoro-1-methylindol-3-yl)-4-[6-(hydroxymethyl)-1-benzofuran-3-yl]pyrrole-2,5-dione |
| SMILES | Cn1cc(C2=C(c3coc4cc(CO)ccc34)C(=O)NC2=O)c2cc(F)c(Cl)cc21 |
| InChI | InChI=1S/C22H14ClFN2O4/c1-26-7-13(12-5-16(24)15(23)6-17(12)26)19-20(22(29)25-21(19)28)14-9-30-18-4-10(8-27)2-3-11(14)18/h2-7,9,27H,8H2,1H3,(H,25,28,29) |
| InChIKey | NZVVXITYPLCRRD-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 84.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.82 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|