C21H14N2O4 — CID 16741730
3-(1-benzofuran-3-yl)-4-(7-hydroxy-1-methylindol-3-yl)pyrrole-2,5-dione (PubChem CID 16741730) has the molecular formula C21H14N2O4 and a molecular weight of 358.35 g/mol. Its IUPAC name is 3-(1-benzofuran-3-yl)-4-(7-hydroxy-1-methylindol-3-yl)pyrrole-2,5-dione.
| Compound Name | 3-(1-benzofuran-3-yl)-4-(7-hydroxy-1-methylindol-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 16741730 |
| Molecular Formula | C21H14N2O4 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | 3-(1-benzofuran-3-yl)-4-(7-hydroxy-1-methylindol-3-yl)pyrrole-2,5-dione |
| SMILES | Cn1cc(C2=C(c3coc4ccccc34)C(=O)NC2=O)c2cccc(O)c21 |
| InChI | InChI=1S/C21H14N2O4/c1-23-9-13(12-6-4-7-15(24)19(12)23)17-18(21(26)22-20(17)25)14-10-27-16-8-3-2-5-11(14)16/h2-10,24H,1H3,(H,22,25,26) |
| InChIKey | GUCSYYMRPJFWDL-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 84.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|