C28H35NO3Si — CID 11225000
(4S)-3-[(4R)-4-hydroxy-5-methyl-3-trimethylsilylhexa-1,2,5-trienyl]-5,5-diphenyl-4-propan-2-yl-1,3-oxazolidin-2-one (PubChem CID 11225000) has the molecular formula C28H35NO3Si and a molecular weight of 461.68 g/mol. Its IUPAC name is (4S)-3-[(4R)-4-hydroxy-5-methyl-3-trimethylsilylhexa-1,2,5-trienyl]-5,5-diphenyl-4-propan-2-yl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-[(4R)-4-hydroxy-5-methyl-3-trimethylsilylhexa-1,2,5-trienyl]-5,5-diphenyl-4-propan-2-yl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11225000 |
| Molecular Formula | C28H35NO3Si |
| Molecular Weight | 461.68 g/mol |
| Exact Mass | 461.24 |
| IUPAC Name | (4S)-3-[(4R)-4-hydroxy-5-methyl-3-trimethylsilylhexa-1,2,5-trienyl]-5,5-diphenyl-4-propan-2-yl-1,3-oxazolidin-2-one |
| SMILES | C=C(C)[C@@H](O)C(=C=CN1C(=O)OC(c2ccccc2)(c2ccccc2)[C@@H]1C(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C28H35NO3Si/c1-20(2)25(30)24(33(5,6)7)18-19-29-26(21(3)4)28(32-27(29)31,22-14-10-8-11-15-22)23-16-12-9-13-17-23/h8-17,19,21,25-26,30H,1H2,2-7H3/t18?,25-,26+/m1/s1 |
| InChIKey | VOHGGNMBFKPVAR-CVUKIUKHSA-N |
| XLogP | 6.26 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.68 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|