C35H66O2Si — CID 11226579
(1R,3aR,4S,5R,7aR)-5-[6-[tert-butyl(dimethyl)silyl]oxy-3-ethenylhexyl]-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-4-prop-2-enyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ol (PubChem CID 11226579) has the molecular formula C35H66O2Si and a molecular weight of 547.00 g/mol. Its IUPAC name is (1R,3aR,4S,5R,7aR)-5-[6-[tert-butyl(dimethyl)silyl]oxy-3-ethenylhexyl]-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-4-prop-2-enyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ol.
| Compound Name | (1R,3aR,4S,5R,7aR)-5-[6-[tert-butyl(dimethyl)silyl]oxy-3-ethenylhexyl]-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-4-prop-2-enyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ol |
|---|---|
| PubChem CID | 11226579 |
| Molecular Formula | C35H66O2Si |
| Molecular Weight | 547.00 g/mol |
| Exact Mass | 546.48 |
| IUPAC Name | (1R,3aR,4S,5R,7aR)-5-[6-[tert-butyl(dimethyl)silyl]oxy-3-ethenylhexyl]-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-4-prop-2-enyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ol |
| SMILES | C=CC[C@]1(O)[C@H](CCC(C=C)CCCO[Si](C)(C)C(C)(C)C)CC[C@]2(C)[C@@H]([C@H](C)CCCC(C)C)CC[C@H]21 |
| InChI | InChI=1S/C35H66O2Si/c1-12-24-35(36)30(20-19-29(13-2)18-15-26-37-38(10,11)33(6,7)8)23-25-34(9)31(21-22-32(34)35)28(5)17-14-16-27(3)4/h12-13,27-32,36H,1-2,14-26H2,3-11H3/t28-,29?,30-,31-,32-,34-,35+/m1/s1 |
| InChIKey | ILLDAKUBDHNKSW-RNTHIRMISA-N |
| XLogP | 10.58 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.00 |
| LogP ≤ 5 | 10.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|