C36H48O5Si — CID 11227100
tert-butyl (E,5S,6S)-7-[tert-butyl(diphenyl)silyl]oxy-5-methyl-6-(phenylmethoxymethoxy)hept-2-enoate (PubChem CID 11227100) has the molecular formula C36H48O5Si and a molecular weight of 588.86 g/mol. Its IUPAC name is tert-butyl (E,5S,6S)-7-[tert-butyl(diphenyl)silyl]oxy-5-methyl-6-(phenylmethoxymethoxy)hept-2-enoate.
| Compound Name | tert-butyl (E,5S,6S)-7-[tert-butyl(diphenyl)silyl]oxy-5-methyl-6-(phenylmethoxymethoxy)hept-2-enoate |
|---|---|
| PubChem CID | 11227100 |
| Molecular Formula | C36H48O5Si |
| Molecular Weight | 588.86 g/mol |
| Exact Mass | 588.33 |
| IUPAC Name | tert-butyl (E,5S,6S)-7-[tert-butyl(diphenyl)silyl]oxy-5-methyl-6-(phenylmethoxymethoxy)hept-2-enoate |
| SMILES | C[C@@H](C/C=C/C(=O)OC(C)(C)C)[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OCOCc1ccccc1 |
| InChI | InChI=1S/C36H48O5Si/c1-29(18-17-25-34(37)41-35(2,3)4)33(39-28-38-26-30-19-11-8-12-20-30)27-40-42(36(5,6)7,31-21-13-9-14-22-31)32-23-15-10-16-24-32/h8-17,19-25,29,33H,18,26-28H2,1-7H3/b25-17+/t29-,33+/m0/s1 |
| InChIKey | VGXMFHQYGSKRQC-PSOVTFSMSA-N |
| XLogP | 7.05 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.86 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|