C42H70O7Si2 — CID 134882676
[(2R,3S,6R,7S)-3,6-bis(phenylmethoxymethoxy)-7-[tri(propan-2-yl)silyloxymethyl]-2,3,6,7-tetrahydrooxepin-2-yl]methoxy-tri(propan-2-yl)silane (PubChem CID 134882676) has the molecular formula C42H70O7Si2 and a molecular weight of 743.19 g/mol. Its IUPAC name is [(2R,3S,6R,7S)-3,6-bis(phenylmethoxymethoxy)-7-[tri(propan-2-yl)silyloxymethyl]-2,3,6,7-tetrahydrooxepin-2-yl]methoxy-tri(propan-2-yl)silane.
| Compound Name | [(2R,3S,6R,7S)-3,6-bis(phenylmethoxymethoxy)-7-[tri(propan-2-yl)silyloxymethyl]-2,3,6,7-tetrahydrooxepin-2-yl]methoxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 134882676 |
| Molecular Formula | C42H70O7Si2 |
| Molecular Weight | 743.19 g/mol |
| Exact Mass | 742.47 |
| IUPAC Name | [(2R,3S,6R,7S)-3,6-bis(phenylmethoxymethoxy)-7-[tri(propan-2-yl)silyloxymethyl]-2,3,6,7-tetrahydrooxepin-2-yl]methoxy-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](OC[C@@H]1O[C@H](CO[Si](C(C)C)(C(C)C)C(C)C)[C@@H](OCOCc2ccccc2)C=C[C@H]1OCOCc1ccccc1)(C(C)C)C(C)C |
| InChI | InChI=1S/C42H70O7Si2/c1-31(2)50(32(3)4,33(5)6)47-27-41-39(45-29-43-25-37-19-15-13-16-20-37)23-24-40(46-30-44-26-38-21-17-14-18-22-38)42(49-41)28-48-51(34(7)8,35(9)10)36(11)12/h13-24,31-36,39-42H,25-30H2,1-12H3/t39-,40+,41+,42- |
| InChIKey | GTBMKMPJWGQISE-RTYOPHJZSA-N |
| XLogP | 10.81 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.19 |
| LogP ≤ 5 | 10.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|