C29H44O4Si — CID 101185878
tert-butyl-dimethyl-[(2R,3S,6R)-4-methylidene-6-[(2S,3S)-3-phenyl-1,4-dioxaspiro[4.5]decan-2-yl]-2-[(E)-prop-1-enyl]oxan-3-yl]oxysilane (PubChem CID 101185878) has the molecular formula C29H44O4Si and a molecular weight of 484.75 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(2R,3S,6R)-4-methylidene-6-[(2S,3S)-3-phenyl-1,4-dioxaspiro[4.5]decan-2-yl]-2-[(E)-prop-1-enyl]oxan-3-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(2R,3S,6R)-4-methylidene-6-[(2S,3S)-3-phenyl-1,4-dioxaspiro[4.5]decan-2-yl]-2-[(E)-prop-1-enyl]oxan-3-yl]oxysilane |
|---|---|
| PubChem CID | 101185878 |
| Molecular Formula | C29H44O4Si |
| Molecular Weight | 484.75 g/mol |
| Exact Mass | 484.30 |
| IUPAC Name | tert-butyl-dimethyl-[(2R,3S,6R)-4-methylidene-6-[(2S,3S)-3-phenyl-1,4-dioxaspiro[4.5]decan-2-yl]-2-[(E)-prop-1-enyl]oxan-3-yl]oxysilane |
| SMILES | C=C1C[C@H]([C@@H]2OC3(CCCCC3)O[C@H]2c2ccccc2)O[C@H](/C=C/C)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H44O4Si/c1-8-15-23-25(33-34(6,7)28(3,4)5)21(2)20-24(30-23)27-26(22-16-11-9-12-17-22)31-29(32-27)18-13-10-14-19-29/h8-9,11-12,15-17,23-27H,2,10,13-14,18-20H2,1,3-7H3/b15-8+/t23-,24-,25+,26+,27+/m1/s1 |
| InChIKey | ZOCSNXQARMOPEE-GTFCXVJCSA-N |
| XLogP | 7.48 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.75 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|