C19H31FO4Si — CID 134934548
tert-butyl-[[(2R,3R,4S,5R)-3-fluoro-5-methoxy-4-phenylmethoxyoxolan-2-yl]methoxy]-dimethylsilane (PubChem CID 134934548) has the molecular formula C19H31FO4Si and a molecular weight of 370.54 g/mol. Its IUPAC name is tert-butyl-[[(2R,3R,4S,5R)-3-fluoro-5-methoxy-4-phenylmethoxyoxolan-2-yl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(2R,3R,4S,5R)-3-fluoro-5-methoxy-4-phenylmethoxyoxolan-2-yl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 134934548 |
| Molecular Formula | C19H31FO4Si |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | tert-butyl-[[(2R,3R,4S,5R)-3-fluoro-5-methoxy-4-phenylmethoxyoxolan-2-yl]methoxy]-dimethylsilane |
| SMILES | CO[C@@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](F)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C19H31FO4Si/c1-19(2,3)25(5,6)23-13-15-16(20)17(18(21-4)24-15)22-12-14-10-8-7-9-11-14/h7-11,15-18H,12-13H2,1-6H3/t15-,16-,17-,18-/m1/s1 |
| InChIKey | ZCVOMZXKOJKBIJ-BRSBDYLESA-N |
| XLogP | 4.30 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|