C35H63NO4Si2 — CID 11227357
(3R,4S,5S)-1-[(4-methoxyphenyl)methyl]-5-pent-4-enyl-3,4-bis[tri(propan-2-yl)silyloxy]pyrrolidin-2-one (PubChem CID 11227357) has the molecular formula C35H63NO4Si2 and a molecular weight of 618.06 g/mol. Its IUPAC name is (3R,4S,5S)-1-[(4-methoxyphenyl)methyl]-5-pent-4-enyl-3,4-bis[tri(propan-2-yl)silyloxy]pyrrolidin-2-one.
| Compound Name | (3R,4S,5S)-1-[(4-methoxyphenyl)methyl]-5-pent-4-enyl-3,4-bis[tri(propan-2-yl)silyloxy]pyrrolidin-2-one |
|---|---|
| PubChem CID | 11227357 |
| Molecular Formula | C35H63NO4Si2 |
| Molecular Weight | 618.06 g/mol |
| Exact Mass | 617.43 |
| IUPAC Name | (3R,4S,5S)-1-[(4-methoxyphenyl)methyl]-5-pent-4-enyl-3,4-bis[tri(propan-2-yl)silyloxy]pyrrolidin-2-one |
| SMILES | C=CCCC[C@H]1[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)C(=O)N1Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C35H63NO4Si2/c1-15-16-17-18-32-33(39-41(24(2)3,25(4)5)26(6)7)34(40-42(27(8)9,28(10)11)29(12)13)35(37)36(32)23-30-19-21-31(38-14)22-20-30/h15,19-22,24-29,32-34H,1,16-18,23H2,2-14H3/t32-,33-,34+/m0/s1 |
| InChIKey | CQQQZNOWSYOWKC-DHWXLLNHSA-N |
| XLogP | 9.88 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.06 |
| LogP ≤ 5 | 9.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|