C46H70OSi2 — CID 11227790
(2S)-2,4-bis[3-tert-butyl-5-[2-tri(propan-2-yl)silylethynyl]phenyl]but-3-yn-2-ol (PubChem CID 11227790) has the molecular formula C46H70OSi2 and a molecular weight of 695.24 g/mol. Its IUPAC name is (2S)-2,4-bis[3-tert-butyl-5-[2-tri(propan-2-yl)silylethynyl]phenyl]but-3-yn-2-ol.
| Compound Name | (2S)-2,4-bis[3-tert-butyl-5-[2-tri(propan-2-yl)silylethynyl]phenyl]but-3-yn-2-ol |
|---|---|
| PubChem CID | 11227790 |
| Molecular Formula | C46H70OSi2 |
| Molecular Weight | 695.24 g/mol |
| Exact Mass | 694.50 |
| IUPAC Name | (2S)-2,4-bis[3-tert-butyl-5-[2-tri(propan-2-yl)silylethynyl]phenyl]but-3-yn-2-ol |
| SMILES | CC(C)[Si](C#Cc1cc(C#C[C@@](C)(O)c2cc(C#C[Si](C(C)C)(C(C)C)C(C)C)cc(C(C)(C)C)c2)cc(C(C)(C)C)c1)(C(C)C)C(C)C |
| InChI | InChI=1S/C46H70OSi2/c1-32(2)48(33(3)4,34(5)6)24-21-39-26-38(27-41(28-39)44(13,14)15)20-23-46(19,47)43-30-40(29-42(31-43)45(16,17)18)22-25-49(35(7)8,36(9)10)37(11)12/h26-37,47H,1-19H3/t46-/m1/s1 |
| InChIKey | UYOCUFLAQZRDNI-YACUFSJGSA-N |
| XLogP | 12.68 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.24 |
| LogP ≤ 5 | 12.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|