C54H65NSi — CID 146681851
12-[3,5-bis(3,5-ditert-butylphenyl)-4-pyridinyl]dodeca-1,3,5,7,9,11-hexaynyl-tri(propan-2-yl)silane (PubChem CID 146681851) has the molecular formula C54H65NSi and a molecular weight of 756.21 g/mol. Its IUPAC name is 12-[3,5-bis(3,5-ditert-butylphenyl)-4-pyridinyl]dodeca-1,3,5,7,9,11-hexaynyl-tri(propan-2-yl)silane.
| Compound Name | 12-[3,5-bis(3,5-ditert-butylphenyl)-4-pyridinyl]dodeca-1,3,5,7,9,11-hexaynyl-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 146681851 |
| Molecular Formula | C54H65NSi |
| Molecular Weight | 756.21 g/mol |
| Exact Mass | 755.49 |
| IUPAC Name | 12-[3,5-bis(3,5-ditert-butylphenyl)-4-pyridinyl]dodeca-1,3,5,7,9,11-hexaynyl-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](C#CC#CC#CC#CC#CC#Cc1c(-c2cc(C(C)(C)C)cc(C(C)(C)C)c2)cncc1-c1cc(C(C)(C)C)cc(C(C)(C)C)c1)(C(C)C)C(C)C |
| InChI | InChI=1S/C54H65NSi/c1-39(2)56(40(3)4,41(5)6)30-28-26-24-22-20-19-21-23-25-27-29-48-49(42-31-44(51(7,8)9)35-45(32-42)52(10,11)12)37-55-38-50(48)43-33-46(53(13,14)15)36-47(34-43)54(16,17)18/h31-41H,1-18H3 |
| InChIKey | YAOOEXRUUPFVAG-UHFFFAOYSA-N |
| XLogP | 13.19 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.21 |
| LogP ≤ 5 | 13.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|