C27H29N — CID 146681888
3,5-bis(4-tert-butylphenyl)-4-ethynylpyridine (PubChem CID 146681888) has the molecular formula C27H29N and a molecular weight of 367.54 g/mol. Its IUPAC name is 3,5-bis(4-tert-butylphenyl)-4-ethynylpyridine.
| Compound Name | 3,5-bis(4-tert-butylphenyl)-4-ethynylpyridine |
|---|---|
| PubChem CID | 146681888 |
| Molecular Formula | C27H29N |
| Molecular Weight | 367.54 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | 3,5-bis(4-tert-butylphenyl)-4-ethynylpyridine |
| SMILES | C#Cc1c(-c2ccc(C(C)(C)C)cc2)cncc1-c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C27H29N/c1-8-23-24(19-9-13-21(14-10-19)26(2,3)4)17-28-18-25(23)20-11-15-22(16-12-20)27(5,6)7/h1,9-18H,2-7H3 |
| InChIKey | BXDVDBVYDCZQKV-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.54 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|