C47H59NSi — CID 146681841
8-[3,5-bis(3,5-ditert-butylphenyl)-4-pyridinyl]octa-1,3,5,7-tetraynyl-triethylsilane (PubChem CID 146681841) has the molecular formula C47H59NSi and a molecular weight of 666.08 g/mol. Its IUPAC name is 8-[3,5-bis(3,5-ditert-butylphenyl)-4-pyridinyl]octa-1,3,5,7-tetraynyl-triethylsilane.
| Compound Name | 8-[3,5-bis(3,5-ditert-butylphenyl)-4-pyridinyl]octa-1,3,5,7-tetraynyl-triethylsilane |
|---|---|
| PubChem CID | 146681841 |
| Molecular Formula | C47H59NSi |
| Molecular Weight | 666.08 g/mol |
| Exact Mass | 665.44 |
| IUPAC Name | 8-[3,5-bis(3,5-ditert-butylphenyl)-4-pyridinyl]octa-1,3,5,7-tetraynyl-triethylsilane |
| SMILES | CC[Si](C#CC#CC#CC#Cc1c(-c2cc(C(C)(C)C)cc(C(C)(C)C)c2)cncc1-c1cc(C(C)(C)C)cc(C(C)(C)C)c1)(CC)CC |
| InChI | InChI=1S/C47H59NSi/c1-16-49(17-2,18-3)26-24-22-20-19-21-23-25-41-42(35-27-37(44(4,5)6)31-38(28-35)45(7,8)9)33-48-34-43(41)36-29-39(46(10,11)12)32-40(30-36)47(13,14)15/h27-34H,16-18H2,1-15H3 |
| InChIKey | FHNCYTKDMVWHLN-UHFFFAOYSA-N |
| XLogP | 12.02 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.08 |
| LogP ≤ 5 | 12.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|