C6H7ClO2 — CID 11228874
(2R)-2-(chloromethyl)-2,3-dihydropyran-6-one (PubChem CID 11228874) has the molecular formula C6H7ClO2 and a molecular weight of 146.57 g/mol. Its IUPAC name is (2R)-2-(chloromethyl)-2,3-dihydropyran-6-one.
| Compound Name | (2R)-2-(chloromethyl)-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 11228874 |
| Molecular Formula | C6H7ClO2 |
| Molecular Weight | 146.57 g/mol |
| Exact Mass | 146.01 |
| IUPAC Name | (2R)-2-(chloromethyl)-2,3-dihydropyran-6-one |
| SMILES | O=C1C=CC[C@H](CCl)O1 |
| InChI | InChI=1S/C6H7ClO2/c7-4-5-2-1-3-6(8)9-5/h1,3,5H,2,4H2/t5-/m1/s1 |
| InChIKey | NVMBKTXDBXNDQK-RXMQYKEDSA-N |
| XLogP | 1.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.57 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|