C11H12F3NO — CID 11229989
2,2,2-trifluoro-N-[(1R)-2-methoxy-1-phenylethyl]ethanimine (PubChem CID 11229989) has the molecular formula C11H12F3NO and a molecular weight of 231.22 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(1R)-2-methoxy-1-phenylethyl]ethanimine.
| Compound Name | 2,2,2-trifluoro-N-[(1R)-2-methoxy-1-phenylethyl]ethanimine |
|---|---|
| PubChem CID | 11229989 |
| Molecular Formula | C11H12F3NO |
| Molecular Weight | 231.22 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 2,2,2-trifluoro-N-[(1R)-2-methoxy-1-phenylethyl]ethanimine |
| SMILES | COC[C@H](/N=C/C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C11H12F3NO/c1-16-7-10(15-8-11(12,13)14)9-5-3-2-4-6-9/h2-6,8,10H,7H2,1H3/b15-8+/t10-/m0/s1 |
| InChIKey | HUUFVGUMNXDTFM-CYANDVJASA-N |
| XLogP | 3.01 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.22 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|