C13H24O5 — CID 11230719
[(2R,3R,5S,6S)-3-but-3-enyl-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]methanol (PubChem CID 11230719) has the molecular formula C13H24O5 and a molecular weight of 260.33 g/mol. Its IUPAC name is [(2R,3R,5S,6S)-3-but-3-enyl-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]methanol.
| Compound Name | [(2R,3R,5S,6S)-3-but-3-enyl-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]methanol |
|---|---|
| PubChem CID | 11230719 |
| Molecular Formula | C13H24O5 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | [(2R,3R,5S,6S)-3-but-3-enyl-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]methanol |
| SMILES | C=CCC[C@H]1O[C@](C)(OC)[C@@](C)(OC)O[C@@H]1CO |
| InChI | InChI=1S/C13H24O5/c1-6-7-8-10-11(9-14)18-13(3,16-5)12(2,15-4)17-10/h6,10-11,14H,1,7-9H2,2-5H3/t10-,11-,12+,13+/m1/s1 |
| InChIKey | LDAHXHXYRPTMSM-NDBYEHHHSA-N |
| XLogP | 1.45 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|