C11H20O6 — CID 54196564
(2R,3S,4S,5R)-2-(hydroxymethyl)-6-pent-1-enoxyoxane-3,4,5-triol (PubChem CID 54196564) has the molecular formula C11H20O6 and a molecular weight of 248.27 g/mol. Its IUPAC name is (2R,3S,4S,5R)-2-(hydroxymethyl)-6-pent-1-enoxyoxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R)-2-(hydroxymethyl)-6-pent-1-enoxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 54196564 |
| Molecular Formula | C11H20O6 |
| Molecular Weight | 248.27 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | (2R,3S,4S,5R)-2-(hydroxymethyl)-6-pent-1-enoxyoxane-3,4,5-triol |
| SMILES | CCCC=COC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C11H20O6/c1-2-3-4-5-16-11-10(15)9(14)8(13)7(6-12)17-11/h4-5,7-15H,2-3,6H2,1H3/t7-,8-,9+,10-,11?/m1/s1 |
| InChIKey | PMFKOSZFVMGQNC-YBTJCZCISA-N |
| XLogP | -0.88 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.27 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|