C11H20O7 — CID 102571608
(2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-(2-hydroxy-2-methylbut-3-enoxy)oxane-3,4,5-triol (PubChem CID 102571608) has the molecular formula C11H20O7 and a molecular weight of 264.27 g/mol. Its IUPAC name is (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-(2-hydroxy-2-methylbut-3-enoxy)oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-(2-hydroxy-2-methylbut-3-enoxy)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 102571608 |
| Molecular Formula | C11H20O7 |
| Molecular Weight | 264.27 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-(2-hydroxy-2-methylbut-3-enoxy)oxane-3,4,5-triol |
| SMILES | C=CC(C)(O)CO[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C11H20O7/c1-3-11(2,16)5-17-10-9(15)8(14)7(13)6(4-12)18-10/h3,6-10,12-16H,1,4-5H2,2H3/t6-,7-,8+,9-,10-,11?/m1/s1 |
| InChIKey | GKMKEUWZFLWKKU-NBNGTGRASA-N |
| XLogP | -2.26 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.27 |
| LogP ≤ 5 | -2.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|