C16H30O7 — CID 85197903
2-(6-hydroxy-2,6-dimethyloct-7-enoxy)-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 85197903) has the molecular formula C16H30O7 and a molecular weight of 334.41 g/mol. Its IUPAC name is 2-(6-hydroxy-2,6-dimethyloct-7-enoxy)-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | 2-(6-hydroxy-2,6-dimethyloct-7-enoxy)-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 85197903 |
| Molecular Formula | C16H30O7 |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | 2-(6-hydroxy-2,6-dimethyloct-7-enoxy)-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | C=CC(C)(O)CCCC(C)COC1OC(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C16H30O7/c1-4-16(3,21)7-5-6-10(2)9-22-15-14(20)13(19)12(18)11(8-17)23-15/h4,10-15,17-21H,1,5-9H2,2-3H3 |
| InChIKey | BTUZVFURXAOVBC-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|