C16H26O3 — CID 11230910
(2R,4S,7R)-7-(methoxymethyl)-2,4,9,11-tetramethyl-1,5-dioxaspiro[5.6]dodeca-8,10-diene (PubChem CID 11230910) has the molecular formula C16H26O3 and a molecular weight of 266.38 g/mol. Its IUPAC name is (2R,4S,7R)-7-(methoxymethyl)-2,4,9,11-tetramethyl-1,5-dioxaspiro[5.6]dodeca-8,10-diene.
| Compound Name | (2R,4S,7R)-7-(methoxymethyl)-2,4,9,11-tetramethyl-1,5-dioxaspiro[5.6]dodeca-8,10-diene |
|---|---|
| PubChem CID | 11230910 |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | (2R,4S,7R)-7-(methoxymethyl)-2,4,9,11-tetramethyl-1,5-dioxaspiro[5.6]dodeca-8,10-diene |
| SMILES | COC[C@H]1C=C(C)C=C(C)CC12O[C@H](C)C[C@H](C)O2 |
| InChI | InChI=1S/C16H26O3/c1-11-6-12(2)9-16(15(7-11)10-17-5)18-13(3)8-14(4)19-16/h6-7,13-15H,8-10H2,1-5H3/t13-,14+,15-,16?/m1/s1 |
| InChIKey | DYVJXDAQXLXYKU-IUOOZAAYSA-N |
| XLogP | 3.46 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |