C10H11ClF3N2O+ — CID 11230920
(Z)-2-[(1S,3S)-3-[(E)-2-chloro-3,3,3-trifluoroprop-1-enyl]-2,2-dimethylcyclopropyl]-2-hydroxyethenediazonium (PubChem CID 11230920) has the molecular formula C10H11ClF3N2O+ and a molecular weight of 267.66 g/mol. Its IUPAC name is (Z)-2-[(1S,3S)-3-[(E)-2-chloro-3,3,3-trifluoroprop-1-enyl]-2,2-dimethylcyclopropyl]-2-hydroxyethenediazonium.
| Compound Name | (Z)-2-[(1S,3S)-3-[(E)-2-chloro-3,3,3-trifluoroprop-1-enyl]-2,2-dimethylcyclopropyl]-2-hydroxyethenediazonium |
|---|---|
| PubChem CID | 11230920 |
| Molecular Formula | C10H11ClF3N2O+ |
| Molecular Weight | 267.66 g/mol |
| Exact Mass | 267.05 |
| IUPAC Name | (Z)-2-[(1S,3S)-3-[(E)-2-chloro-3,3,3-trifluoroprop-1-enyl]-2,2-dimethylcyclopropyl]-2-hydroxyethenediazonium |
| SMILES | CC1(C)[C@H](/C=C(/Cl)C(F)(F)F)[C@@H]1/C(O)=C/[N+]#N |
| InChI | InChI=1S/C10H10ClF3N2O/c1-9(2)5(3-7(11)10(12,13)14)8(9)6(17)4-16-15/h3-5,8H,1-2H3/p+1/b6-4-,7-3+/t5-,8-/m1/s1 |
| InChIKey | JBLXELHSKQISBB-KERYVWNESA-O |
| XLogP | 4.20 |
| TPSA | 48.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.66 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|