C17H22ClN3O2 — CID 11232961
3-[[(2S)-2-chlorobut-3-enyl]amino]-2-[(1S)-1-hydroxy-2,2-dimethylpropyl]quinazolin-4-one (PubChem CID 11232961) has the molecular formula C17H22ClN3O2 and a molecular weight of 335.84 g/mol. Its IUPAC name is 3-[[(2S)-2-chlorobut-3-enyl]amino]-2-[(1S)-1-hydroxy-2,2-dimethylpropyl]quinazolin-4-one.
| Compound Name | 3-[[(2S)-2-chlorobut-3-enyl]amino]-2-[(1S)-1-hydroxy-2,2-dimethylpropyl]quinazolin-4-one |
|---|---|
| PubChem CID | 11232961 |
| Molecular Formula | C17H22ClN3O2 |
| Molecular Weight | 335.84 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 3-[[(2S)-2-chlorobut-3-enyl]amino]-2-[(1S)-1-hydroxy-2,2-dimethylpropyl]quinazolin-4-one |
| SMILES | C=C[C@H](Cl)CNn1c([C@@H](O)C(C)(C)C)nc2ccccc2c1=O |
| InChI | InChI=1S/C17H22ClN3O2/c1-5-11(18)10-19-21-15(14(22)17(2,3)4)20-13-9-7-6-8-12(13)16(21)23/h5-9,11,14,19,22H,1,10H2,2-4H3/t11-,14+/m0/s1 |
| InChIKey | NAUPRHUZALRIEP-SMDDNHRTSA-N |
| XLogP | 2.81 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.84 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|