C17H23ClN2O — CID 83145007
2-(1-chloroethyl)-3-(2,3,3-trimethylbutyl)quinazolin-4-one (PubChem CID 83145007) has the molecular formula C17H23ClN2O and a molecular weight of 306.84 g/mol. Its IUPAC name is 2-(1-chloroethyl)-3-(2,3,3-trimethylbutyl)quinazolin-4-one.
| Compound Name | 2-(1-chloroethyl)-3-(2,3,3-trimethylbutyl)quinazolin-4-one |
|---|---|
| PubChem CID | 83145007 |
| Molecular Formula | C17H23ClN2O |
| Molecular Weight | 306.84 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | 2-(1-chloroethyl)-3-(2,3,3-trimethylbutyl)quinazolin-4-one |
| SMILES | CC(Cl)c1nc2ccccc2c(=O)n1CC(C)C(C)(C)C |
| InChI | InChI=1S/C17H23ClN2O/c1-11(17(3,4)5)10-20-15(12(2)18)19-14-9-7-6-8-13(14)16(20)21/h6-9,11-12H,10H2,1-5H3 |
| InChIKey | FQDSSDIZZUGNAC-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.84 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|