C19H20Cl2N2O2 — CID 11234325
(2S)-1-[[2-chloro-4-[(3-chlorophenyl)methoxy]phenyl]methyl]pyrrolidine-2-carboxamide (PubChem CID 11234325) has the molecular formula C19H20Cl2N2O2 and a molecular weight of 379.29 g/mol. Its IUPAC name is (2S)-1-[[2-chloro-4-[(3-chlorophenyl)methoxy]phenyl]methyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[[2-chloro-4-[(3-chlorophenyl)methoxy]phenyl]methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 11234325 |
| Molecular Formula | C19H20Cl2N2O2 |
| Molecular Weight | 379.29 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | (2S)-1-[[2-chloro-4-[(3-chlorophenyl)methoxy]phenyl]methyl]pyrrolidine-2-carboxamide |
| SMILES | NC(=O)[C@@H]1CCCN1Cc1ccc(OCc2cccc(Cl)c2)cc1Cl |
| InChI | InChI=1S/C19H20Cl2N2O2/c20-15-4-1-3-13(9-15)12-25-16-7-6-14(17(21)10-16)11-23-8-2-5-18(23)19(22)24/h1,3-4,6-7,9-10,18H,2,5,8,11-12H2,(H2,22,24)/t18-/m0/s1 |
| InChIKey | JWZRRYAXTNODEL-SFHVURJKSA-N |
| XLogP | 4.02 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.29 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |