C16H13Cl2NaO3 — CID 70629345
sodium 3-[2-chloro-4-[(3-chlorophenyl)methoxy]phenyl]propanoate (PubChem CID 70629345) has the molecular formula C16H13Cl2NaO3 and a molecular weight of 347.17 g/mol. Its IUPAC name is sodium 3-[2-chloro-4-[(3-chlorophenyl)methoxy]phenyl]propanoate.
| Compound Name | sodium 3-[2-chloro-4-[(3-chlorophenyl)methoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 70629345 |
| Molecular Formula | C16H13Cl2NaO3 |
| Molecular Weight | 347.17 g/mol |
| Exact Mass | 346.01 |
| IUPAC Name | sodium 3-[2-chloro-4-[(3-chlorophenyl)methoxy]phenyl]propanoate |
| SMILES | O=C([O-])CCc1ccc(OCc2cccc(Cl)c2)cc1Cl.[Na+] |
| InChI | InChI=1S/C16H14Cl2O3.Na/c17-13-3-1-2-11(8-13)10-21-14-6-4-12(15(18)9-14)5-7-16(19)20;/h1-4,6,8-9H,5,7,10H2,(H,19,20);/q;+1/p-1 |
| InChIKey | FZYKRISWBPOWKS-UHFFFAOYSA-M |
| XLogP | 0.26 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.17 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |