C22H20O6 — CID 11234348
[(2R)-1-(5,7-dimethoxy-3,4-dioxonaphthalen-2-yl)propan-2-yl] benzoate (PubChem CID 11234348) has the molecular formula C22H20O6 and a molecular weight of 380.40 g/mol. Its IUPAC name is [(2R)-1-(5,7-dimethoxy-3,4-dioxonaphthalen-2-yl)propan-2-yl] benzoate.
| Compound Name | [(2R)-1-(5,7-dimethoxy-3,4-dioxonaphthalen-2-yl)propan-2-yl] benzoate |
|---|---|
| PubChem CID | 11234348 |
| Molecular Formula | C22H20O6 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | [(2R)-1-(5,7-dimethoxy-3,4-dioxonaphthalen-2-yl)propan-2-yl] benzoate |
| SMILES | COc1cc2c(c(OC)c1)C(=O)C(=O)C(C[C@@H](C)OC(=O)c1ccccc1)=C2 |
| InChI | InChI=1S/C22H20O6/c1-13(28-22(25)14-7-5-4-6-8-14)9-16-10-15-11-17(26-2)12-18(27-3)19(15)21(24)20(16)23/h4-8,10-13H,9H2,1-3H3/t13-/m1/s1 |
| InChIKey | NCJFXWSYZJUCSO-CYBMUJFWSA-N |
| XLogP | 3.49 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|