C27H33N5 — CID 11235688
N-[2-[2-(3,3-diphenylpropyl)-1H-imidazol-5-yl]ethyl]-4-(1H-imidazol-5-yl)butan-1-amine (PubChem CID 11235688) has the molecular formula C27H33N5 and a molecular weight of 427.60 g/mol. Its IUPAC name is N-[2-[2-(3,3-diphenylpropyl)-1H-imidazol-5-yl]ethyl]-4-(1H-imidazol-5-yl)butan-1-amine.
| Compound Name | N-[2-[2-(3,3-diphenylpropyl)-1H-imidazol-5-yl]ethyl]-4-(1H-imidazol-5-yl)butan-1-amine |
|---|---|
| PubChem CID | 11235688 |
| Molecular Formula | C27H33N5 |
| Molecular Weight | 427.60 g/mol |
| Exact Mass | 427.27 |
| IUPAC Name | N-[2-[2-(3,3-diphenylpropyl)-1H-imidazol-5-yl]ethyl]-4-(1H-imidazol-5-yl)butan-1-amine |
| SMILES | c1ccc(C(CCc2ncc(CCNCCCCc3cnc[nH]3)[nH]2)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H33N5/c1-3-9-22(10-4-1)26(23-11-5-2-6-12-23)14-15-27-30-20-25(32-27)16-18-28-17-8-7-13-24-19-29-21-31-24/h1-6,9-12,19-21,26,28H,7-8,13-18H2,(H,29,31)(H,30,32) |
| InChIKey | DBKIPTDCISZMBW-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.60 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|