C27H31NO4 — CID 11235859
3-[4-[(3R)-3-(4-ethyl-2-pyridin-4-ylphenoxy)butoxy]-2-methylphenyl]propanoic acid (PubChem CID 11235859) has the molecular formula C27H31NO4 and a molecular weight of 433.55 g/mol. Its IUPAC name is 3-[4-[(3R)-3-(4-ethyl-2-pyridin-4-ylphenoxy)butoxy]-2-methylphenyl]propanoic acid.
| Compound Name | 3-[4-[(3R)-3-(4-ethyl-2-pyridin-4-ylphenoxy)butoxy]-2-methylphenyl]propanoic acid |
|---|---|
| PubChem CID | 11235859 |
| Molecular Formula | C27H31NO4 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.23 |
| IUPAC Name | 3-[4-[(3R)-3-(4-ethyl-2-pyridin-4-ylphenoxy)butoxy]-2-methylphenyl]propanoic acid |
| SMILES | CCc1ccc(O[C@H](C)CCOc2ccc(CCC(=O)O)c(C)c2)c(-c2ccncc2)c1 |
| InChI | InChI=1S/C27H31NO4/c1-4-21-5-9-26(25(18-21)23-11-14-28-15-12-23)32-20(3)13-16-31-24-8-6-22(19(2)17-24)7-10-27(29)30/h5-6,8-9,11-12,14-15,17-18,20H,4,7,10,13,16H2,1-3H3,(H,29,30)/t20-/m1/s1 |
| InChIKey | OAZGGHCYFQETEG-HXUWFJFHSA-N |
| XLogP | 5.87 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |