C36H38FNO6 — CID 25191879
4-[2-(2-carboxyethyl)-3-[6-[3-(3-fluorophenyl)-5-pyridin-4-ylphenoxy]hexyl]phenoxy]butanoic acid (PubChem CID 25191879) has the molecular formula C36H38FNO6 and a molecular weight of 599.70 g/mol. Its IUPAC name is 4-[2-(2-carboxyethyl)-3-[6-[3-(3-fluorophenyl)-5-pyridin-4-ylphenoxy]hexyl]phenoxy]butanoic acid.
| Compound Name | 4-[2-(2-carboxyethyl)-3-[6-[3-(3-fluorophenyl)-5-pyridin-4-ylphenoxy]hexyl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 25191879 |
| Molecular Formula | C36H38FNO6 |
| Molecular Weight | 599.70 g/mol |
| Exact Mass | 599.27 |
| IUPAC Name | 4-[2-(2-carboxyethyl)-3-[6-[3-(3-fluorophenyl)-5-pyridin-4-ylphenoxy]hexyl]phenoxy]butanoic acid |
| SMILES | O=C(O)CCCOc1cccc(CCCCCCOc2cc(-c3ccncc3)cc(-c3cccc(F)c3)c2)c1CCC(=O)O |
| InChI | InChI=1S/C36H38FNO6/c37-31-11-5-10-28(23-31)30-22-29(26-16-18-38-19-17-26)24-32(25-30)43-20-4-2-1-3-8-27-9-6-12-34(33(27)14-15-36(41)42)44-21-7-13-35(39)40/h5-6,9-12,16-19,22-25H,1-4,7-8,13-15,20-21H2,(H,39,40)(H,41,42) |
| InChIKey | MMQNTSKAYCJEQT-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 105.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.70 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|