C22H26F3NO5 — CID 11236048
(2R,3R,4S,5S,6R)-2-[2-[(4-ethylphenyl)methyl]-4-(trifluoromethyl)anilino]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 11236048) has the molecular formula C22H26F3NO5 and a molecular weight of 441.45 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-[2-[(4-ethylphenyl)methyl]-4-(trifluoromethyl)anilino]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-2-[2-[(4-ethylphenyl)methyl]-4-(trifluoromethyl)anilino]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 11236048 |
| Molecular Formula | C22H26F3NO5 |
| Molecular Weight | 441.45 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[2-[(4-ethylphenyl)methyl]-4-(trifluoromethyl)anilino]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CCc1ccc(Cc2cc(C(F)(F)F)ccc2N[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C22H26F3NO5/c1-2-12-3-5-13(6-4-12)9-14-10-15(22(23,24)25)7-8-16(14)26-21-20(30)19(29)18(28)17(11-27)31-21/h3-8,10,17-21,26-30H,2,9,11H2,1H3/t17-,18-,19+,20-,21-/m1/s1 |
| InChIKey | VIEYBYVFSLJDHT-YMQHIKHWSA-N |
| XLogP | 2.07 |
| TPSA | 102.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.45 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |