C18H26O10S2 — CID 11236666
[(2R,3R,4S,5S)-2,3,4,5-tetraacetyloxy-5-(1,3-dithiolan-2-yl)pentyl] acetate (PubChem CID 11236666) has the molecular formula C18H26O10S2 and a molecular weight of 466.53 g/mol. Its IUPAC name is [(2R,3R,4S,5S)-2,3,4,5-tetraacetyloxy-5-(1,3-dithiolan-2-yl)pentyl] acetate.
| Compound Name | [(2R,3R,4S,5S)-2,3,4,5-tetraacetyloxy-5-(1,3-dithiolan-2-yl)pentyl] acetate |
|---|---|
| PubChem CID | 11236666 |
| Molecular Formula | C18H26O10S2 |
| Molecular Weight | 466.53 g/mol |
| Exact Mass | 466.10 |
| IUPAC Name | [(2R,3R,4S,5S)-2,3,4,5-tetraacetyloxy-5-(1,3-dithiolan-2-yl)pentyl] acetate |
| SMILES | CC(=O)OC[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H](OC(C)=O)C1SCCS1 |
| InChI | InChI=1S/C18H26O10S2/c1-9(19)24-8-14(25-10(2)20)15(26-11(3)21)16(27-12(4)22)17(28-13(5)23)18-29-6-7-30-18/h14-18H,6-8H2,1-5H3/t14-,15-,16+,17+/m1/s1 |
| InChIKey | HIMBJEFWXSLVNP-NCOADZHNSA-N |
| XLogP | 1.08 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.53 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|