C20H32O10S2 — CID 2825759
[(2R,3S,4S,5R)-2,3,4,5-tetraacetyloxy-6,6-bis(ethylsulfanyl)hexyl] acetate (PubChem CID 2825759) has the molecular formula C20H32O10S2 and a molecular weight of 496.60 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-2,3,4,5-tetraacetyloxy-6,6-bis(ethylsulfanyl)hexyl] acetate.
| Compound Name | [(2R,3S,4S,5R)-2,3,4,5-tetraacetyloxy-6,6-bis(ethylsulfanyl)hexyl] acetate |
|---|---|
| PubChem CID | 2825759 |
| Molecular Formula | C20H32O10S2 |
| Molecular Weight | 496.60 g/mol |
| Exact Mass | 496.14 |
| IUPAC Name | [(2R,3S,4S,5R)-2,3,4,5-tetraacetyloxy-6,6-bis(ethylsulfanyl)hexyl] acetate |
| SMILES | CCSC(SCC)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O |
| InChI | InChI=1S/C20H32O10S2/c1-8-31-20(32-9-2)19(30-15(7)25)18(29-14(6)24)17(28-13(5)23)16(27-12(4)22)10-26-11(3)21/h16-20H,8-10H2,1-7H3/t16-,17+,18+,19-/m1/s1 |
| InChIKey | NFCGRENOZDIGBW-YDZRNGNQSA-N |
| XLogP | 2.11 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.60 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|