C26H22F3N3O4S — CID 11237867
(5Z)-5-[[1-[3-[[7-propyl-3-(trifluoromethyl)-1,2-benzoxazol-6-yl]oxy]propyl]indol-5-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 11237867) has the molecular formula C26H22F3N3O4S and a molecular weight of 529.54 g/mol. Its IUPAC name is (5Z)-5-[[1-[3-[[7-propyl-3-(trifluoromethyl)-1,2-benzoxazol-6-yl]oxy]propyl]indol-5-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[1-[3-[[7-propyl-3-(trifluoromethyl)-1,2-benzoxazol-6-yl]oxy]propyl]indol-5-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 11237867 |
| Molecular Formula | C26H22F3N3O4S |
| Molecular Weight | 529.54 g/mol |
| Exact Mass | 529.13 |
| IUPAC Name | (5Z)-5-[[1-[3-[[7-propyl-3-(trifluoromethyl)-1,2-benzoxazol-6-yl]oxy]propyl]indol-5-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CCCc1c(OCCCn2ccc3cc(/C=C4\SC(=O)NC4=O)ccc32)ccc2c(C(F)(F)F)noc12 |
| InChI | InChI=1S/C26H22F3N3O4S/c1-2-4-17-20(8-6-18-22(17)36-31-23(18)26(27,28)29)35-12-3-10-32-11-9-16-13-15(5-7-19(16)32)14-21-24(33)30-25(34)37-21/h5-9,11,13-14H,2-4,10,12H2,1H3,(H,30,33,34)/b21-14- |
| InChIKey | USPFZFXPTKCHDU-STZFKDTASA-N |
| XLogP | 6.55 |
| TPSA | 86.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.54 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|