C19H20N2O6S — CID 1123865
(4-nitrophenyl)methyl 1-(benzenesulfonyl)piperidine-4-carboxylate (PubChem CID 1123865) has the molecular formula C19H20N2O6S and a molecular weight of 404.44 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 1-(benzenesulfonyl)piperidine-4-carboxylate.
| Compound Name | (4-nitrophenyl)methyl 1-(benzenesulfonyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 1123865 |
| Molecular Formula | C19H20N2O6S |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | (4-nitrophenyl)methyl 1-(benzenesulfonyl)piperidine-4-carboxylate |
| SMILES | O=C(OCc1ccc([N+](=O)[O-])cc1)C1CCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C19H20N2O6S/c22-19(27-14-15-6-8-17(9-7-15)21(23)24)16-10-12-20(13-11-16)28(25,26)18-4-2-1-3-5-18/h1-9,16H,10-14H2 |
| InChIKey | GNVGMDBDVQJTSG-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|