C21H22N2O8S — CID 24980253
(4-nitrophenyl)methyl 1-(2-methoxycarbonylphenyl)sulfonylpiperidine-4-carboxylate (PubChem CID 24980253) has the molecular formula C21H22N2O8S and a molecular weight of 462.48 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 1-(2-methoxycarbonylphenyl)sulfonylpiperidine-4-carboxylate.
| Compound Name | (4-nitrophenyl)methyl 1-(2-methoxycarbonylphenyl)sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 24980253 |
| Molecular Formula | C21H22N2O8S |
| Molecular Weight | 462.48 g/mol |
| Exact Mass | 462.11 |
| IUPAC Name | (4-nitrophenyl)methyl 1-(2-methoxycarbonylphenyl)sulfonylpiperidine-4-carboxylate |
| SMILES | COC(=O)c1ccccc1S(=O)(=O)N1CCC(C(=O)OCc2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C21H22N2O8S/c1-30-21(25)18-4-2-3-5-19(18)32(28,29)22-12-10-16(11-13-22)20(24)31-14-15-6-8-17(9-7-15)23(26)27/h2-9,16H,10-14H2,1H3 |
| InChIKey | MXZRJGZSOJQSQX-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 133.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.48 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|